
CAS 58755-91-2: 2-(4-chlorophenyl)butanedioic acid
Formula:C10H9ClO4
InChI:InChI=1/C10H9ClO4/c11-7-3-1-6(2-4-7)8(10(14)15)5-9(12)13/h1-4,8H,5H2,(H,12,13)(H,14,15)
SMILES:c1cc(ccc1C(CC(=O)O)C(=O)O)Cl
Synonyms:- 2-(4-Chlorophenyl)succinic acid
- Butanedioic Acid, 2-(4-Chlorophenyl)-
Sort by
Found 3 products.
2-(4-Chlorophenyl)succinic acid
CAS:2-(4-Chlorophenyl)succinic acid is a chiral compound that can be used in the enantioseparation of baclofen. It is an enantiopure and enantiomerically pure compound that has shown to have an optimized catalytic activity and yields. 2-(4-Chlorophenyl)succinic acid is a ligand that binds to the enzyme butanoic acid oxidoreductase, which converts butanoic acid into butyric acid. This reaction has been optimized in order to increase the yield of this product by using a catalyst that is more efficient at converting the substrate into product.Formula:C10H9ClO4Purity:Min. 95%Molecular weight:228.63 g/mol2-(4-CHLORO-PHENYL)-SUCCINIC ACID
CAS:Formula:C10H9ClO4Purity:95%Color and Shape:SolidMolecular weight:228.62912-(4-Chlorophenyl)succinic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:228.6300048828125