N-(4-Chloro-2-fluorophenyl)acetamide, with the CAS number 59280-70-5, is an organic compound characterized by its acetamide functional group attached to a substituted aromatic ring. The presence of a chloro and a fluoro group on the phenyl ring contributes to its unique chemical properties, including potential reactivity and solubility characteristics. This compound typically appears as a solid at room temperature and is soluble in organic solvents. Its molecular structure suggests it may exhibit biological activity, making it of interest in pharmaceutical research. The chlorine and fluorine substituents can influence the compound's electronic properties, potentially affecting its interactions with biological targets. Additionally, N-(4-Chloro-2-fluorophenyl)acetamide may undergo various chemical reactions, such as nucleophilic substitutions or hydrolysis, depending on the conditions. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, this compound is a valuable subject of study in organic chemistry and medicinal chemistry contexts.

N-(4-Chloro-2-fluorophenyl)acetamide

59280-70-5: 2'-Fluoro-4'-chloroacetanilide, 4[-Chloro-2[-fluoroacetanilide, Acetamide, N-(4-chloro-2-fluorophenyl)-, N-(4-Chloro-2-fluorophenyl)acetamide,  N-Acetyl-4-chloro-2-fluoroaniline,   , 

4'-Chloro-2'-fluoroacetanilide

4'-CHLORO-2'-FLUOROACETANILIDE

N-(4-chloro-2-fluorophenyl)acetamide is an industrial chemical that is used in the production of dyes, pharmaceuticals, and herbicides. It is also used in the synthesis of pharmaceuticals as a ligand. This compound undergoes cyclization to form acetic acid, which can be further processed to yield 4-iodotoluene.

CAS 59280-70-5: N-(4-Chloro-2-fluorophenyl)acetamide

4'-Chloro-2'-fluoroacetanilide

Ref: 10-F003156

4'-CHLORO-2'-FLUOROACETANILIDE

Ref: IN-DA003L31

N-(4-chloro-2-fluorophenyl)acetamide

Ref: 3D-FC105125

4'-Chloro-2'-fluoroacetanilide

Ref: 54-PC1815

4'-Chloro-2'-fluoroacetanilide

Ref: 3B-C1692