
CAS 59404-86-3: 4-(benzyloxy)-3-chloroaniline
Formula:C13H12ClNO
InChI:InChI=1/C13H12ClNO/c14-12-8-11(15)6-7-13(12)16-9-10-4-2-1-3-5-10/h1-8H,9,15H2
SMILES:c1ccc(cc1)COc1ccc(cc1Cl)N
Synonyms:- Benzenamine, 3-Chloro-4-(Phenylmethoxy)-
Sort by
Found 4 products.
4-Benzyloxy-3-chloroaniline
CAS:Formula:C13H12ClNOPurity:98%Color and Shape:SolidMolecular weight:233.693479999999974-(Benzyloxy)-3-Chloroaniline
CAS:4-(Benzyloxy)-3-ChloroanilinePurity:98%Molecular weight:233.69g/mol4-(Benzyloxy)-3-chloroaniline
CAS:4-(Benzyloxy)-3-chloroaniline is an allylation reagent that is used to synthesize other molecules. The propargylation reaction of this molecule involves the addition of an allyl group to the benzene ring in the presence of hydrochloric acid and a base. This chemical is also used in stereoselective oximination reactions, which are used for the synthesis of heterocycles. 4-(Benzyloxy)-3-chloroaniline is reactive and produces many functional groups, including chloride and hydrochloric acid. It can be used as a cellular growth inhibitor that has been shown to inhibit proliferation of cancer cells at high concentrations.Formula:C13H12ClNOPurity:Min. 95%Molecular weight:233.69 g/mol