
CAS 59587-07-4: 2-azidoadenosine
Formula:C10H12N8O4
InChI:InChI=1/C10H12N8O4/c11-7-4-8(15-10(14-7)16-17-12)18(2-13-4)9-6(21)5(20)3(1-19)22-9/h2-3,5-6,9,19-21H,1H2,(H2,11,14,15)/t3-,5-,6-,9-/m1/s1
SMILES:C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)nc(nc23)N=[N+]=[NH-])O1)O)O)O
Synonyms:- Adenosine, 2-Azido-
Sort by
Found 4 products.
2-Azido-adenosine
CAS:2-Azido-adenosine is a click chemistry reagent featuring an azide group. This compound undergoes a copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing an alkyne group. Additionally, it can react with molecules having DBCO or BCN groups through a strain-promoted alkyne-azide cycloaddition (SPAAC).Formula:C10H12N8O4Color and Shape:SolidMolecular weight:308.252-Azidoadenosine
CAS:2-Azidoadenosine is a nucleoside analog of adenosine, where the 2'-hydroxyl group of the ribose sugar is replaced with an azido group (-N₃). This substitution imparts unique chemical properties, notably enabling molecules to undergo bioorthogonal reactions, such as click chemistry, which involves the cycloaddition of the azide group with alkynes.Formula:C10H12H8O4Purity:Min. 95%Color and Shape:PowderMolecular weight:308.25 g/mol2-Azido Adenosine
CAS:Controlled ProductFormula:C10H12N8O4Color and Shape:NeatMolecular weight:308.25