
CAS 6006-06-0: (5E)-5-(5-bromo-2,4-dimethoxybenzylidene)-1-(4-methoxyphenyl)pyrimidine-2,4,6(1H,3H,5H)-trione
Formula:C20H17BrN2O6
InChI:InChI=1/C20H17BrN2O6/c1-27-13-6-4-12(5-7-13)23-19(25)14(18(24)22-20(23)26)8-11-9-15(21)17(29-3)10-16(11)28-2/h4-10H,1-3H3,(H,22,24,26)/b14-8+
Synonyms:- 2,4,6(1H,3H,5H)-pyrimidinetrione, 5-[(5-bromo-2,4-dimethoxyphenyl)methylene]-1-(4-methoxyphenyl)-, (5E)-
Sort by
Found 4 products.
12-TRIDECANOIC ACID
CAS:Formula:C13H24O2Purity:98%Color and Shape:SolidMolecular weight:212.3284600000000412-Tridecanoic acid
CAS:12-Tridecanoic acid is a saturated fatty acid, which is typically derived from natural sources such as vegetable oils or synthesized through organic chemical methods. This compound is characterized by its twelve-carbon chain, which imparts unique physicochemical properties. The mode of action of 12-Tridecanoic acid involves its integration into lipid bilayers, influencing membrane fluidity and participating in cellular signaling pathways. It can also act as a precursor for the synthesis of other complex molecules, thereby playing a crucial role in metabolic processes. In scientific research, 12-Tridecanoic acid is utilized for its potential antimicrobial properties, as well as its influence on lipid metabolism. These characteristics make it an important subject of study for developing novel therapeutics and understanding lipid-associated diseases. Additionally, its applications extend to the industrial sector, where it is employed in the production of surfactants, lubricants, and chemical intermediates. The versatile nature and biological significance of 12-Tridecanoic acid continue to drive research into its various functions and potential enhancements in biochemical and industrial processes.Purity:Min. 95%