
CAS 601-99-0: 2-Hydroxy-6-nitrobenzoic acid
Formula:C7H5NO5
InChI:InChI=1S/C7H5NO5/c9-5-3-1-2-4(8(12)13)6(5)7(10)11/h1-3,9H,(H,10,11)
InChI key:InChIKey=QICHZWUWPVMQTD-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N(=O)=O)C=CC=C1O
Synonyms:- 2-Hydroxy-6-nitrobenzoic acid
- Salicylic acid, 6-nitro-
- 6-Nitrosalicylic acid
- Benzoic acid, 2-hydroxy-6-nitro-
Sort by
Found 4 products.
2-Hydroxy-6-nitrobenzoic acid
CAS:Formula:C7H5NO5Purity:98%Color and Shape:SolidMolecular weight:183.11832-Hydroxy-6-nitrobenzoic acid
CAS:2-Hydroxy-6-nitrobenzoic acid is a computational study of an anionic protonated salicylic acid. It has been shown that the protonated salicylic acid can be stabilized by electron donation from anthranilic acid, which leads to the formation of an anion. The hydrogen transfer between the two molecules leads to the formation of a neutral compound. This mechanism is supported by computational studies and has been proposed as a possible mechanism for the synthesis of 2-hydroxy-6-nitrobenzoic acid from salicylic acid.Formula:C7H5NO5Purity:Min. 95%Molecular weight:183.12 g/mol2-Hydroxy-6-nitrobenzoic acid
CAS:2-Hydroxy-6-nitrobenzoic acidPurity:95%Molecular weight:183.12g/mol