
CAS 60469-88-7: benzoic acid, 3,4-dibromo-, ethyl ester
Formula:C9H8Br2O2
InChI:InChI=1/C9H8Br2O2/c1-2-13-9(12)6-3-4-7(10)8(11)5-6/h3-5H,2H2,1H3
SMILES:CCOC(=O)c1ccc(c(c1)Br)Br
Sort by
Found 3 products.
3,4-Dibromobenzoic acid ethyl ester
CAS:3,4-Dibromobenzoic acid ethyl ester is a high quality reagent that can be used as an intermediate for the synthesis of complex compounds. It is also useful as a building block for the synthesis of speciality chemicals and research chemicals. 3,4-Dibromobenzoic acid ethyl ester can be used in reactions such as Friedel-Crafts reactions, reducing reactions, and condensations. This chemical is a versatile building block that can be used to construct organic molecules with diverse structures. 3,4-Dibromobenzoic acid ethyl ester is a fine chemical with CAS number 60469-88-7.Formula:C9H8Br2O2Purity:Min. 95%Molecular weight:307.97 g/mol3,4-DIBROMOBENZOIC ACID ETHYL ESTER
CAS:Formula:C9H8Br2O2Purity:97%Color and Shape:SolidMolecular weight:307.9666