![N'-[(Z)-3H-indol-3-ylidenemethyl]-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carbohydrazide](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F310047-n-z-3h-indol-3-ylidenemethyl-1-4-methoxyphenyl-5-oxopyrrolidine-3-carbohydrazide.webp&w=3840&q=75)
CAS 6054-10-0: N'-[(Z)-3H-indol-3-ylidenemethyl]-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carbohydrazide
Formula:C21H20N4O3
InChI:InChI=1/C21H20N4O3/c1-28-17-8-6-16(7-9-17)25-13-14(10-20(25)26)21(27)24-23-12-15-11-22-19-5-3-2-4-18(15)19/h2-9,11-12,14,23H,10,13H2,1H3,(H,24,27)/b15-12+
Sort by
Found 3 products.
Braylin
CAS:Braylin is an innovative polymer material, which is synthesized from a unique formulation of advanced macromolecules. This product is developed using a proprietary chemical process that involves the polymerization of monomers with specific side-chain functionalities. The result is a versatile polymer with dynamic and reversible adhesive properties, achieved through non-covalent interactions, such as hydrogen bonding and Van der Waals forces. Braylin's significant attribute lies in its capacity to repeatedly adhere and detach from surfaces when activated or deactivated by external stimuli, such as temperature shifts or changes in pH. This characteristic is particularly beneficial in laboratories focused on smart materials and adaptive surface technologies, where control over adhesion properties is crucial. Applications of Braylin span various scientific fields, including the development of responsive coatings, fabrication of reconfigurable sensors, and the creation of transient electronic devices. The material’s tunable adhesive properties provide researchers with a robust tool for exploring new concepts in material science, particularly in the context of dynamic systems and intelligent materials.Formula:C15H14O4Purity:Min. 95%Molecular weight:258.27 g/molBraylin
CAS:Braylin has anti-inflammatory, antinociceptive and immunomodulatory effects, which possibly act through the glucocorticoid receptor activation and by inhibitionFormula:C15H14O4Purity:98%Color and Shape:SolidMolecular weight:258.27