
CAS 606-19-9: 2-Hydroxy-1,3-benzenedicarboxylic acid
Formula:C8H6O5
InChI:InChI=1S/C8H6O5/c9-6-4(7(10)11)2-1-3-5(6)8(12)13/h1-3,9H,(H,10,11)(H,12,13)
InChI key:InChIKey=WVDGHGISNBRCAO-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(O)C(C(O)=O)=CC=C1
Synonyms:- 1,3-Benzenedicarboxylic Acid, 2-Hydroxy-
- 2-Hydroxy-1,3-benzene dicarboxylic acid
- 2-Hydroxy-1,3-benzenedicarboxylic acid
- 2-Hydroxyisophthalic acid
- Isophthalic acid, 2-hydroxy-
- NSC 252689
Sort by
Found 4 products.
2-Hydroxyisophthalic acid
CAS:2-Hydroxyisophthalic acid is a hydroxylated derivative of p-hydroxybenzoic acid. It is used in the manufacture of esters such as 2-ethoxyethanol and 2-ethoxyethyl acetate. It has also been shown to have a number of enzyme activities, including esterases, glycosidases, and lipases. The macrocyclic structure of 2-hydroxyisophthalic acid is responsible for its ability to interact with other molecules through hydrogen bonding and coordination chemistry. The carboxylate group on 2-hydroxyisophthalic acid interacts with the hydroxy group on the fatty acids found in soap, which leads to its use as an emulsifying agent. The carbonyl oxygens on 2-hydroxyisophthalic acid are responsible for its anti-inflammatory properties as they inhibit prostaglandin synthesis when they bind to the cyclooxygenase enzymes that catalyzeFormula:C8H6O5Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:182.13 g/mol2-Hydroxyisophthalic acid
CAS:2-Hydroxyisophthalic acidColor and Shape:SolidMolecular weight:182.13g/mol