CAS 611-40-5: Tectoridin
Formula:C22H22O11
InChI:InChI=1S/C22H22O11/c1-30-21-13(32-22-20(29)19(28)17(26)14(7-23)33-22)6-12-15(18(21)27)16(25)11(8-31-12)9-2-4-10(24)5-3-9/h2-6,8,14,17,19-20,22-24,26-29H,7H2,1H3/t14-,17-,19+,20-,22-/m1/s1
InChI key:InChIKey=CNOURESJATUGPN-UDEBZQQRSA-N
SMILES:O=C1C=2C(=CC(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)=C(OC)C2O)OC=C1C4=CC=C(O)C=C4
Synonyms:- 4H-1-Benzopyran-4-one, 7-(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-5-hydroxy-3-(4-hydroxyphenyl)-6-methoxy-
- 5-Hydroxy-3-(4-hydroxyphenyl)-6-methoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
- 5-hydroxy-3-(4-hydroxyphenyl)-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
- 7-(β-<span class="text-smallcaps">D</span>-Glucopyranosyloxy)-5-hydroxy-3-(4-hydroxyphenyl)-6-methoxy-4H-1-benzopyran-4-one
- Shekanin
- Tectorigenin 7-O-β-<span class="text-smallcaps">D</span>-glucopyranoside
- 7-(β-D-Glucopyranosyloxy)-5-hydroxy-3-(4-hydroxyphenyl)-6-methoxy-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 7-(β-D-glucopyranosyloxy)-5-hydroxy-3-(4-hydroxyphenyl)-6-methoxy-
- Tectorigenin 7-O-β-D-glucopyranoside
- Tectoridin
Sort by
Found 8 products.
Tectoridin
CAS:Tectoridin activates estrogen/thyroid receptors; has anti-inflammatory, antioxidant, hypoglycemic effects; inhibits rat aldose reductase (IC: 1.4-15.5 μM).Formula:C22H22O11Purity:99.02% - 99.48%Color and Shape:SolidMolecular weight:462.4Tectoridin
CAS:Natural glycosideFormula:C22H22O11Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:462.41Tectoridin
CAS:Formula:C22H22O11Purity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:462.41Tectoridin
CAS:Formula:C22H22O11Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:462.41Tectoridin
CAS:Tectoridin is a naturally occurring isoflavone glycoside, which is derived from the rhizomes of the Iris plant, particularly from Iris tectorum. This compound acts as a bioactive isoflavone that can undergo enzymatic hydrolysis to release tectorigenin, the aglycone form. Tectoridin and its metabolites are investigated for their pharmacological properties, which include antioxidant, anti-inflammatory, and anti-cancer activities. The mode of action of tectoridin involves modulating various biochemical pathways that contribute to its potential therapeutic effects. It has been shown to inhibit oxidative stress markers and modulate the expression of multiple proteins involved in inflammation and cell proliferation. Tectoridin is primarily explored for its uses in the prevention and treatment of various diseases. Its anti-cancer properties are of particular interest, as it may inhibit tumor growth and induce apoptosis in certain cancer cell lines. Additionally, the compound is studied for its potential protective effects against liver damage and its ability to improve metabolic profiles, making it a candidate for managing conditions like liver diseases and metabolic disorders.Formula:C22H22O11Purity:Min. 95%Color and Shape:White PowderMolecular weight:462.4 g/mol
