
CAS 61501-04-0: α-(1,1-Dimethylethyl)benzenemethanamine
Formula:C11H17N
InChI:InChI=1S/C11H17N/c1-11(2,3)10(12)9-7-5-4-6-8-9/h4-8,10H,12H2,1-3H3
InChI key:InChIKey=INGIGRKEXZOVTB-UHFFFAOYSA-N
SMILES:C(C(C)(C)C)(N)C1=CC=CC=C1
Synonyms:- 2,2-Dimethyl-1-Phenyl-Propylamine
- 2,2-Dimethyl-1-phenylpropylamine
- Benzenemethanamine, Α-(1,1-Dimethylethyl)-
- Benzylamine, α-tert-butyl-
- α-(1,1-Dimethylethyl)benzenemethanamine
- α-tert-Butylbenzylamine
- ω-Phenyl-tert-butyl-methylamine
Sort by
Found 4 products.
2,2-Dimethyl-1-phenyl-propylamine
CAS:2,2-Dimethyl-1-phenyl-propylaminePurity:98%Color and Shape:SolidMolecular weight:163.26g/mol2,2-Dimethyl-1-phenylpropylamine
CAS:Purity:95.0%Color and Shape:LiquidMolecular weight:163.264007568359382,2-Dimethyl-1-phenyl-propylamine
CAS:2,2-Dimethyl-1-phenyl-propylamine is a chiral molecule that is synthesized in two steps. First, an imine is formed by reacting a phenyl ring with an amino acid derived from the 2,2-dimethylbenzaldehyde. The second step involves the use of a biocatalyst to form an asymmetric synthesis of the racemic mixture using carbonyl as the leaving group and one of three different alkylating agents. The product then undergoes hydrogenation to yield the desired enantiomer (S) and (R). This compound has been found to have reactive properties due to its ability to form hydrogen bonds and its conformation.Purity:Min. 95%Ref: 3D-FD142671
Discontinued product2,2-Dimethyl-1-phenylpropan-1-amine
CAS:Formula:C11H17NPurity:96%Color and Shape:LiquidMolecular weight:163.25938