
CAS 619-20-5: 3-ethylbenzoic acid
Formula:C9H10O2
InChI:InChI=1/C9H10O2/c1-2-7-4-3-5-8(6-7)9(10)11/h3-6H,2H2,1H3,(H,10,11)
SMILES:CCc1cccc(c1)C(=O)O
Synonyms:- Benzoic Acid, 3-Ethyl-
- 3-Ethylbenzoic acid
Sort by
Found 4 products.
c3-Ethylbenzoic acid
CAS:C3-Ethylbenzoic acid is an organic compound that can be synthesized from the reactants ethyl bromide, propylene oxide, and acetic anhydride. The synthesis of C3-Ethylbenzoic acid is a stepwise process in which the starting materials are converted to intermediates and then reacted to form the desired product. The reaction mechanism involves bond cleavage, which generates a carboxylic acid group on one end of the molecule and a phenyl group on the other end. C3-Ethylbenzoic acid interacts with clausamine and isoprene during transport through cell membranes. This interaction may lead to increased permeability of cell membranes by c3-ethylbenzoic acid.Formula:C9H10O2Purity:Min. 95%Molecular weight:150.17 g/mol