
CAS 6192-01-4: (2E)-3-Ethoxyacrylic acid
Formula:C5H8O3
InChI:InChI=1/C5H8O3/c1-2-8-4-3-5(6)7/h3-4H,2H2,1H3,(H,6,7);
Synonyms:- 3-Ethoxyacrylic Acid
- 2-propenoic acid, 3-ethoxy-, (2E)-
Sort by
Found 5 products.
3-Ethoxyprop-2-enoic acid
CAS:Please enquire for more information about 3-Ethoxyprop-2-enoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C5H8O3Purity:Min. 95%Molecular weight:116.11 g/mol3-Ethoxy-2-propenoic acid
CAS:3-Ethoxy-2-propenoic acid is a substrate for the synthesis of dasatinib, an anti-cancer drug. The reaction products are formed from a nucleophilic substitution mechanism and can be used to synthesize other drugs. 3-Ethoxy-2-propenoic acid is generally obtained by the reaction of ethyl diazoacetate with chloride in vivo. The synthesis of this compound has been shown to be catalyzed by aryl diazo compounds and oxygenated compounds such as 2,2′-diazobis(2,4-dimethylvaleronitrile) (DBMDVN).Formula:C5H8O3Purity:Min. 95%Molecular weight:116.12 g/molRef: 3D-FE38909
Discontinued product