
CAS 62252-10-2: 5,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)-2,3-dihydro-4H-chromen-4-one
Formula:C18H18O7
InChI:InChI=1/C18H18O7/c1-22-15-4-9(5-16(23-2)18(15)24-3)13-8-12(21)17-11(20)6-10(19)7-14(17)25-13/h4-7,13,19-20H,8H2,1-3H3
SMILES:COc1cc(cc(c1OC)OC)C1CC(=O)c2c(cc(cc2O1)O)O
Synonyms:- 4H-1-benzopyran-4-one, 2,3-dihydro-5,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)-
- 5,7-Dihydroxy-2-(3,4,5-trimethoxyphenyl)-2,3-dihydro-4H-chromen-4-on
- 5,7-Dihydroxy-2-(3,4,5-trimethoxyphenyl)-4-chromanone
- 5,7-Dihydroxy-2-(3,4,5-trimethoxyphenyl)-2,3-dihydro-4H-chromen-4-one
- 5,7-Dihydroxy-2-(3,4,5-triméthoxyphényl)-2,3-dihydro-4H-chromén-4-one
Sort by
Found 4 products.
5,7-Dihydroxy-3',4',5'-trimethoxyflavanone
CAS:5,7-Dihydroxy-3',4',5'-trimethoxyflavanone analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C18H18O7Purity:(HPLC) ≥90%Color and Shape:PowderMolecular weight:346.345,7-Dihydroxy-3',4',5'-trimethoxyflavanone
CAS:5,7-Dihydroxy-3',4',5'-trimethoxyflavanone is a natural product for research related to life sciences.Formula:C18H18O7Purity:98%Color and Shape:SolidMolecular weight:346.335,7-Dihydroxy-3',4',5'-trimethoxyflavanone
CAS:5,7-Dihydroxy-3',4',5'-trimethoxyflavanone is a flavanone compound, which is a type of polyphenolic compound found predominantly in the plant kingdom. This compound can be sourced from various plants, where it often occurs as part of the natural defense mechanisms to protect the organism from environmental stressors. The mode of action of 5,7-Dihydroxy-3',4',5'-trimethoxyflavanone involves its potential antioxidant properties. It functions by scavenging free radicals and reducing oxidative stress within biological systems. The presence of hydroxyl and methoxy groups is crucial for its activity, allowing it to donate hydrogen atoms and electrons to neutralize reactive oxygen species. In scientific research, this compound is used to study its potential health benefits, particularly its ability to mitigate oxidative damage linked to chronic diseases such as cardiovascular ailments and neurodegenerative disorders. It also serves as a valuable chemical model for synthesizing novel compounds with enhanced antioxidant activities. The exploration of its efficacy in biological systems continues to elucidate its role and applications in medicinal chemistry and pharmacology.Formula:C18H18O7Purity:Min. 95%Molecular weight:346.33 g/mol