CAS 62876-66-8: 5-(Dimethylamino)-2-nitrobenzoic acid
Formula:C9H10N2O4
InChI:InChI=1S/C9H10N2O4/c1-10(2)6-3-4-8(11(14)15)7(5-6)9(12)13/h3-5H,1-2H3,(H,12,13)
InChI key:InChIKey=RIBZKYVKDZGFBP-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N(=O)=O)C=CC(N(C)C)=C1
Synonyms:- Benzoic acid, 5-(dimethylamino)-2-nitro-
- 5-(Dimethylamino)-2-nitrobenzoic acid
- 2-Nitro-5-dimethylaminobenzoic acid
Sort by
Found 3 products.
5-(dimethylamino)-2-nitrobenzoic acid
CAS:Formula:C9H10N2O4Purity:95%Color and Shape:SolidMolecular weight:210.18675-(dimethylamino)-2-nitrobenzoic acid
CAS:5-(dimethylamino)-2-nitrobenzoic acid is a benzamide that can be used to synthesize polymers. It has a molecular weight of 176.2 and a melting point of 178°C. 5-(dimethylamino)-2-nitrobenzoic acid has the ability to form hydrogen bonds and undergoes spontaneous crystallization. This compound also has a low molecular weight, making it amenable for use in liquid crystal displays. 5-(dimethylamino)-2-nitrobenzoic acid is chiral, meaning it can exist in two forms: one form is dextrorotatory and the other is levorotatory. The dextrorotatory form of this compound is called levo-5-(dimethylamino)-2-nitrobenzoic acid or DMABN, while the levorotatory form is called dextro-5-(dimethylamino)-2-nitrobenFormula:C9H10N2O4Purity:Min. 95%Molecular weight:210.19 g/mol
