CAS 6291-07-2: 5-chloronaphthalene-1-sulfonyl chloride
Formula:C10H6Cl2O2S
InChI:InChI=1/C10H6Cl2O2S/c11-9-5-1-4-8-7(9)3-2-6-10(8)15(12,13)14/h1-6H
SMILES:c1cc2c(cccc2S(=O)(=O)Cl)c(c1)Cl
Sort by
Found 4 products.
5-Chloronaphthalene-1-sulfonyl chloride
CAS:5-Chloronaphthalene-1-sulfonyl chloride is a pyrazole derivative that inhibits the activity of transglutaminase, an enzyme involved in the crosslinking of proteins. It also inhibits protein kinases, which are enzymes that regulate the activity of other proteins by adding a phosphate group to them. 5-Chloronaphthalene-1-sulfonyl chloride binds to cations such as chloride and hydrogen bonds with amino acids in protein molecules. The compound has shown selectivity for calmodulin antagonists over other types of protein kinase inhibitors.Formula:C10H6Cl2O2SPurity:Min. 95%Color and Shape:Yellow PowderMolecular weight:261.12 g/molRef: 3D-FC20292
Discontinued product5-Chloronaphthalene-1-sulfonyl Chloride
CAS:Controlled ProductApplications 5-Chloronaphthalene-1-sulfonyl Chloride (cas# 6291-07-2) is a compound useful in organic synthesis.Formula:C10H6Cl2O2SColor and Shape:NeatMolecular weight:261.125-Chloronaphthalene-1-sulphonyl chloride
CAS:5-Chloronaphthalene-1-sulphonyl chlorideFormula:C10H6Cl2O2SPurity:95% (nmr) (Typical Value in Batch COA)Color and Shape: pale yellow solidMolecular weight:261.12g/mol
