
CAS 630067-06-0: 1,10-phenanthroline-5-carboxylic acid
Formula:C13H8N2O2
InChI:InChI=1/C13H8N2O2/c16-13(17)10-7-8-3-1-5-14-11(8)12-9(10)4-2-6-15-12/h1-7H,(H,16,17)
SMILES:c1cc2cc(c3cccnc3c2nc1)C(=O)O
Synonyms:- 1,10-Phenanthroline-5-Carboxylicacid
Sort by
Found 4 products.
1,10-Phenanthroline-5-carboxylic acid
CAS:1,10-Phenanthroline-5-carboxylic acidPurity:95%Molecular weight:224.22g/mol1,10-Phenanthroline-5-carboxylic acid
CAS:Formula:C13H8N2O2Purity:95%Color and Shape:SolidMolecular weight:224.21481,10-Phenanthroline-5-carboxylic acid
CAS:Phenanthroline-5-carboxylic acid is a ligand that binds to the active site of the enzyme neuraminidase, which is an enzyme that degrades sialic acid. This compound forms a ruthenium complex with dopamine and has been shown to have cytotoxic effects on cancer cells in vitro. Phenanthroline-5-carboxylic acid's mechanism of action is due to its ability to induce apoptosis by peroxide formation, which leads to cell death. It also has luminescent and optical properties that are useful for microscopy.Formula:C13H8N2O2Purity:Min. 95%Molecular weight:224.21 g/molRef: 3D-FP180172
Discontinued product1,10-Phenanthroline-5-carboxylic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:224.218994140625