
CAS 63399-38-2: 2-Pentenoic acid, 5-(decahydro-6-hydroxy-5,5,8a-trimethyl-2-methylene-1-naphthalenyl)-3-methyl-, [1S-(1α,4aβ,6α,8aα)]-
Formula:C20H32O3
InChI:InChI=1S/C20H32O3/c1-13(12-18(22)23)6-8-15-14(2)7-9-16-19(3,4)17(21)10-11-20(15,16)5/h12,15-17,21H,2,6-11H2,1,3-5H3,(H,22,23)/t15-,16-,17-,20+/m0/s1
InChI key:InChIKey=LNWOKEZJIRLIDO-OGNFBWPZSA-N
SMILES:C[C@@]12[C@](C(C)(C)[C@@H](O)CC1)(CCC(=C)[C@@H]2CCC(=CC(O)=O)C)[H]
Synonyms:- 2-Pentenoic acid, 5-(decahydro-6-hydroxy-5,5,8a-trimethyl-2-methylene-1-naphthalenyl)-3-methyl-, [1S-(1α,4aβ,6α,8aα)]-
Sort by
Found 4 products.
Alepterolic acid
CAS:Alepterolic acid exhibits larvicidal properties against Aedes aegypti (L.) (Diptera, Culicidae), with LC50 of 87.3 ppm.Formula:C20H32O3Purity:98%Color and Shape:SolidMolecular weight:320.473Alepterolic acid
CAS:Alepterolic acid is a naturally occurring fungal metabolite, which is isolated from certain species of fungi known for producing various bioactive compounds. As a bioactive compound, it functions by inhibiting the enzyme squalene epoxidase, a critical enzyme in the cholesterol biosynthesis pathway. This enzymatic inhibition results in reducing cholesterol levels, demonstrating potential therapeutic applications in managing hypercholesterolemia. Research into alepterolic acid focuses on its role in cholesterol regulation and its potential benefits in cardiovascular health. Its specific mechanism of action positions it as a promising candidate for the development of novel therapeutic agents aimed at controlling cholesterol levels. Further studies are needed to explore its efficacy and safety profiles. Additionally, alepterolic acid is of interest in the field of natural product chemistry, where its structure and bioactivity can inspire the synthesis of analogs for enhanced pharmacological applications.Formula:C20H32O3Purity:Min. 95%Molecular weight:320.5 g/mol