
CAS 6345-67-1: 5-nitro-2-(phenylsulfanyl)benzoic acid
Formula:C13H9NO4S
InChI:InChI=1/C13H9NO4S/c15-13(16)11-8-9(14(17)18)6-7-12(11)19-10-4-2-1-3-5-10/h1-8H,(H,15,16)
SMILES:c1ccc(cc1)Sc1ccc(cc1C(=O)O)N(=O)=O
Synonyms:- Benzoic Acid, 5-Nitro-2-(Phenylthio)-
Sort by
Found 2 products.
5-Nitro-2-(phenylthio)benzoic acid
CAS:5-Nitro-2-(phenylthio)benzoic acid is an efficient and versatile synthetic intermediate for a wide range of organic compounds. It has been synthesized from n-phenylanthranilic acid, potassium carbonate, and potassium nitrate. The synthesis can also be carried out using carbonates such as sodium or calcium, which are more readily available. 5-Nitro-2-(phenylthio)benzoic acid is prepared by the amination of an alkylamine with nitric acid followed by heating to superheat the reaction mixture. This process yields the desired product in high yields (90%). The compound is also used to produce other derivatives such as phenylnitrosamine and 2,3-dinitrophenol.Formula:C13H9NO4SPurity:Min. 95%Molecular weight:275.28 g/molRef: 3D-FN131594
Discontinued product