CAS 63569-07-3: 11,13-Dihydrohelenalin tiglate
Formula:C20H26O5
InChI:InChI=1S/C20H26O5/c1-6-10(2)18(22)25-17-16-12(4)19(23)24-14(16)9-11(3)13-7-8-15(21)20(13,17)5/h6-8,11-14,16-17H,9H2,1-5H3/b10-6+/t11-,12+,13+,14-,16-,17+,20+/m1/s1
InChI key:InChIKey=KUPPZVXLWANEJJ-YFVRYKHXSA-N
SMILES:O(C(/C(=C/C)/C)=O)[C@H]1[C@]2([C@@](C[C@@H](C)[C@]3([C@@]1(C)C(=O)C=C3)[H])(OC(=O)[C@H]2C)[H])[H]
Synonyms:- 11,13-Dihydrohelenalin tiglate
- 2-Butenoic acid, 2-methyl-, (3S,3aR,4S,4aR,7aR,8R,9aR)-2,3,3a,4,4a,5,7a,8,9,9a-decahydro-3,4a,8-trimethyl-2,5-dioxoazuleno(6,5-b)furan-4-yl ester, (2E)-
- 2-Butenoic acid, 2-methyl-, 2,3,3a,4,4a,5,7a,8,9,9a-decahydro-3,4a,8-trimethyl-2,5-dioxoazuleno[6,5-b]furan-4-yl ester, [3S-[3α,3aβ,4β(E),4aα,7aβ,8β,9aβ]]-
- 6-O-Tigloyl-11,13-dihydrohelenalin
- 6-O-Tiglyol-11α,13-dihydrohelenalin
- Azuleno[6,5-b]furan, 2-butenoic acid deriv.
- Microhelenalin C
- Microhelenin C
Sort by
Found 7 products.
Microhelenin C
CAS:Microhelenin C has significant antileukemic activity.Formula:C20H26O5Purity:94.41% - 95.35%Color and Shape:SolidMolecular weight:346.42Ref: TM-TN1932
1mg116.00€5mg281.00€10mg429.00€25mg692.00€50mg935.00€100mg1,340.00€1mL*10mM (DMSO)296.00€(E)-(3S,3aR,4S,4aR,7aR,8R,9aR)-3,4a,8-trimethyl-2,5-dioxo-2,3,3a,4,4a,5,7a,8,9,9a-decahydroazuleno[6,5-b]furan-4-yl 2-methylbut-2-enoate
CAS:Formula:C20H26O5Purity:95%Color and Shape:SolidMolecular weight:346.4174Microhelenin C
CAS:Microhelenin C is a sesquiterpene lactone, which is a naturally occurring compound derived from plants in the Asteraceae family. These compounds are known for their bioactive properties, and Microhelenin C, in particular, is extracted from specific plant species within this family. Its mode of action involves the inhibition of NF-kB signaling pathways, which are crucial in the processes of inflammation and cellular proliferation. By disrupting these pathways, Microhelenin C exhibits potential anti-inflammatory and anticancer effects. Microhelenin C is primarily studied for its applications in biomedical research, particularly in understanding and developing treatments for conditions characterized by excessive inflammation and cancer. Its ability to interfere with key signaling pathways makes it a candidate for further exploration in drug development processes aimed at treating chronic inflammatory diseases and various forms of cancer. Research continues to explore its efficacy, potential therapeutic benefits, and mechanisms of action to better understand how it might be harnessed in clinical settings.Formula:C20H26O5Purity:Min. 95%Molecular weight:346.4 g/mol
