
CAS 63631-41-4: Phenol, 4-(3,4-dihydro-7-methoxy-2H-1-benzopyran-3-yl)-3-methoxy-
Formula:C17H18O4
InChI:InChI=1S/C17H18O4/c1-19-14-5-3-11-7-12(10-21-16(11)9-14)15-6-4-13(18)8-17(15)20-2/h3-6,8-9,12,18H,7,10H2,1-2H3
InChI key:InChIKey=RQPCHUUIUGRXGY-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC(O)=C1)C2CC=3C(OC2)=CC(OC)=CC3
Synonyms:- Arvensan
- Phenol, 4-(3,4-dihydro-7-methoxy-2H-1-benzopyran-3-yl)-3-methoxy-
Sort by
Found 1 products.
Arvensan
CAS:Arvensan is a bioactive compound that acts as a biocide, derived from natural sources such as certain plant species. Its primary mode of action involves disrupting the cellular membranes of target microorganisms, leading to cell lysis and eventual death. This mechanism ensures efficacy against a broad spectrum of bacteria and fungi, demonstrating its potential as a versatile microbial control agent. In practical applications, Arvensan is utilized in various fields requiring microbial management, including agriculture, where it serves to protect crops from pathogen infestation. Additionally, its properties make it suitable for use in the formulation of eco-friendly disinfectants. Research continues to explore its adaptability in other sectors, such as food preservation and healthcare, underscoring its significance as a sustainable alternative to synthetic biocides. The ongoing investigation aims to refine its effectiveness and broaden its application base, making it an intriguing subject for scientific exploration.Formula:C17H18O4Purity:Min. 95%Molecular weight:286.32 g/mol