
CAS 640769-65-9: 3',4'-dimethoxybiphenyl-4-carbaldehyde
Formula:C15H14O3
InChI:InChI=1/C15H14O3/c1-17-14-8-7-13(9-15(14)18-2)12-5-3-11(10-16)4-6-12/h3-10H,1-2H3
SMILES:COc1ccc(cc1OC)c1ccc(cc1)C=O
Synonyms:- [1,1'-Biphenyl]-4-carboxaldehyde, 3',4'-dimethoxy-
- 3',4'-Dimethoxybiphenyl-4-carbaldehyde
Sort by
Found 3 products.
3',4'-DIMETHOXYBIPHENYL-4-CARBALDEHYDE
CAS:Formula:C15H14O3Purity:97%Color and Shape:SolidMolecular weight:242.269863',4'-Dimethoxybiphenyl-4-carbaldehyde
CAS:3',4'-Dimethoxybiphenyl-4-carbaldehyde is a psychotherapeutic drug that is used to treat depression. It inhibits the reuptake of both serotonin and dopamine, which leads to an increase in the amount of these neurotransmitters in the brain. This drug has been shown to be effective against symptoms of depression, but does not have any effect on weight gain or appetite. 3',4'-Dimethoxybiphenyl-4-carbaldehyde is metabolized by enzymes such as dehydrogenase, leading to its active form 3,4-dimethoxybenzaldehyde. This compound binds to kallikrein and causes it to release bradykinin and other substances that are responsible for vasodilation and increased blood flow. 3',4'-Dimethoxybiphenyl-4-carbaldehyde is also an antidiabetic agent that can reduce blood sugar levels by stimulating insulin secretion from pancreatic beta cells.Formula:C15H14O3Purity:Min. 95%Molecular weight:242.27 g/mol