CAS 66108-30-3: 2'-hydroxy-5'-methyl-3'-nitroacetophenone
Formula:C9H9NO4
InChI:InChI=1/C9H9NO4/c1-5-3-7(6(2)11)9(12)8(4-5)10(13)14/h3-4,12H,1-2H3
SMILES:Cc1cc(C(=O)C)c(c(c1)N(=O)=O)O
Sort by
Found 5 products.
2'-Hydroxy-5'-methyl-3'-nitroacetophenone
CAS:Formula:C9H9NO4Purity:>98.0%(GC)(T)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:195.172-Hydroxy-5-methyl-3-nitroacetophenone
CAS:2-Hydroxy-5-methyl-3-nitroacetophenone is a molecule that has inhibitory activities against hydrogen bond formation. It can be used as a photophysical probe to study intramolecular hydrogen bonding in the human serum. The hydroxyl group in 2-hydroxy-5-methyl-3-nitroacetophenone is polar and can form hydrogen bonds with other polar molecules, such as nitro groups. This molecule has been shown to have inhibitory effects against bacteria such as Pseudomonas aeruginosa and Clostridium perfringens. 2-hydroxy-5 methyl 3 nitro acetophenone is thermodynamically stable in water and exhibits a boiling point of 126 degrees Celsius at atmospheric pressure.Formula:C9H9NO4Purity:Min. 95%Molecular weight:195.17 g/mol2'-Hydroxy-5'-methyl-3'-nitroacetophenone
CAS:Purity:97.0%Color and Shape:Solid, NeedlesMolecular weight:195.17399597167972-Hydroxy-5-Methyl-3-Nitroacetophenone
CAS:2-Hydroxy-5-Methyl-3-NitroacetophenonePurity:98%Molecular weight:195.17g/mol2'-HYDROXY-5'-METHYL-3'-NITROACETOPHENONE
CAS:Formula:C9H9NO4Purity:98%Color and Shape:SolidMolecular weight:195.17205999999996
