
CAS 6665-72-1: 5-Hydroxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one
Formula:C16H12O4
InChI:InChI=1S/C16H12O4/c1-19-11-7-5-10(6-8-11)15-9-13(18)16-12(17)3-2-4-14(16)20-15/h2-9,17H,1H3
InChI key:InChIKey=WAGFUKCEIMCKQR-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC(=C1)C3=CC=C(OC)C=C3)=CC=CC2O
Synonyms:- 5-Hydroxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 5-hydroxy-2-(4-methoxyphenyl)-
- NSC 123408
- Flavone, 5-hydroxy-4′-methoxy-
Sort by
Found 1 products.
5-Hydroxy-4'-methoxyflavone
CAS:5-Hydroxy-4'-methoxyflavone is a naturally occurring flavone, which is a type of polyphenolic compound found in various plants. It is derived from natural sources such as fruits, vegetables, and certain herbs. This compound is part of the larger class of flavonoids, which are known for their various biological activities and potential health benefits. The mode of action of 5-Hydroxy-4'-methoxyflavone involves multiple biochemical pathways. It may exert antioxidative properties by scavenging free radicals and modulating oxidative stress. Additionally, it could influence signaling pathways related to inflammation, cell cycle regulation, and apoptosis, although the precise mechanisms may vary depending on the specific cellular context and concentration. Research into the applications of 5-Hydroxy-4'-methoxyflavone is ongoing, with studies exploring its potential roles in pharmacological and nutraceutical contexts. It is being investigated for its possible effects on chronic conditions where oxidative stress and inflammation play a critical role. Furthermore, its potential neuroprotective, cardioprotective, and anticancer properties are subjects of scientific interest, making it a candidate for further detailed studies aimed at therapeutic development.Formula:C16H12O4Purity:Min. 95%Molecular weight:268.26 g/mol