CAS 6686-70-0: destruxin A from metarhizium anisopliae
Formula:C29H47N5O7
InChI:InChI=1/C29H47N5O7/c1-9-12-21-27(38)34-16-11-13-20(34)26(37)31-23(18(5)10-2)28(39)33(8)24(17(3)4)29(40)32(7)19(6)25(36)30-15-14-22(35)41-21/h9,17-21,23-24H,1,10-16H2,2-8H3,(H,30,36)(H,31,37)
SMILES:C=CCC1C(=O)N2CCCC2C(=NC(C(C)CC)C(=O)N(C)C(C(C)C)C(=O)N(C)C(C)C(=NCCC(=O)O1)O)O
Synonyms:- Destruxin A
- Brn 0601694
- Nsc 361126
- 3-(butan-2-yl)-5,8,9-trimethyl-6-(propan-2-yl)-16-(prop-2-en-1-yl)dodecahydropyrrolo[1,2-d][1,4,7,10,13,16]oxapentaazacyclononadecine-1,4,7,10,14,17(11H,16H)-hexone
Sort by
Found 4 products.
Destruxin A
CAS:Destruxin A is a cyclodepsipeptide, which is a specialized secondary metabolite originating from the entomopathogenic fungus, Metarhizium anisopliae. This bioactive compound exerts its effects through a multifaceted mode of action, primarily disrupting ion channels and perturbing cellular homeostasis within insect hosts. The interference with calcium and potassium ion fluxes leads to paralysis and ultimately death of the targeted pests, making it an effective biocontrol agent. Destruxin A holds significant potential in integrated pest management programs, particularly in agriculture, where it offers a sustainable alternative to synthetic chemical pesticides. Its specificity to insect physiology ensures minimal impacts on non-target organisms, promoting ecological balance. Studies continue to explore its application spectrum and effectiveness, seeking to optimize its deployment in various pest-infested environments, including crops and stored products.Formula:C29H47N5O7Purity:Min. 95%Color and Shape:PowderMolecular weight:577.71 g/molDestruxin A from Metarhizium anisopliae
CAS:Destruxin A from Metarhizium anisopliaeColor and Shape:SolidMolecular weight:577.71g/molDestruxin A
CAS:Formula:C29H47N5O7Purity:≥ 97.0%Color and Shape:White, off-white or pale yellow powderMolecular weight:577.71Destruxin A
CAS:Destruxin A is a cyclic hexadepsipeptide produced by fungus causing paralysis and death in insects.Formula:C29H47N5O7Purity:98%Color and Shape:SolidMolecular weight:577.71
