
CAS 67127-91-7: 2,5-bis(benzyloxy)benzoic acid
Formula:C21H18O4
InChI:InChI=1/C21H18O4/c22-21(23)19-13-18(24-14-16-7-3-1-4-8-16)11-12-20(19)25-15-17-9-5-2-6-10-17/h1-13H,14-15H2,(H,22,23)
SMILES:c1ccc(cc1)COc1ccc(c(c1)C(=O)O)OCc1ccccc1
Synonyms:- Benzoic acid, 2,5-bis(phenylmethoxy)-
- 2,5-Bis(benzyloxy)benzoic acid
Sort by
Found 3 products.
2,5-Bis(benzyloxy)benzoic acid
CAS:Formula:C21H18O4Purity:98%Color and Shape:SolidMolecular weight:334.36522,5-Bis-benzyloxy-benzoic acid
CAS:Purity:96.0%Color and Shape:SolidMolecular weight:334.37100219726562,5-Bis(benzyloxy)benzoic acid
CAS:2,5-Bis(benzyloxy)benzoic acid is a dihydroxybenzoic acid that is used as a catalyst in the synthesis of benzyl chloride. It reacts with benzyl chloride by cleavage of the ester group to form an alcohol and benzylic acid. 2,5-Bis(benzyloxy)benzoic acid also reacts with water to produce hydrogen peroxide.Formula:C21H18O4Purity:Min. 95%Molecular weight:334.37 g/mol