
CAS 6720-26-9: 2'-formylbiphenyl-2-carboxylic acid
Formula:C14H10O3
InChI:InChI=1/C14H10O3/c15-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14(16)17/h1-9H,(H,16,17)
SMILES:c1ccc(c(c1)C=O)c1ccccc1C(=O)O
Synonyms:- [1,1'-Biphenyl]-2-carboxylic acid, 2'-formyl-
- 2'-Formyl[1,1'-Biphenyl]-2-Carboxylic Acid
- 2'-Formylbiphenyl-2-carboxylic acid
Sort by
Found 4 products.
2'-Formylbiphenyl-2-carboxylic acid
CAS:2'-Formylbiphenyl-2-carboxylic acid is a particulate air pollutant. It is formed by the oxidation of phthalic acid, which is an important precursor in the production of polyesters and plastics. The chemical process starts with the reaction of molecular oxygen with phthalic acid to form 2-formylbenzoic acid, which then reacts with molecular oxygen again to form 2'-formylbiphenyl-2-carboxylic acid. The rate at which this reaction occurs depends on temperature, concentration and wavelength. This reaction can be catalyzed by metal ions such as copper or manganese. The gas phase mechanism for this reaction is also possible. 2'-Formylbiphenyl-2-carboxylic acid has been shown to be a diastereoisomeric mixture that contains two enantiomers: R-(+)-2'-formylbiphenyl-2-carboxyFormula:C14H10O3Purity:Min. 95%Molecular weight:226.23 g/molRef: 3D-FF131425
Discontinued product2'-Formyl-biphenyl-2-carboxylic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:226.23100280761722'-Formyl-[1,1'-biphenyl]-2-carboxylic acid
CAS:2'-Formyl-[1,1'-biphenyl]-2-carboxylic acidFormula:C14H10O3Purity:96% (nmr) (Typical Value in Batch COA)Color and Shape: beige solidMolecular weight:226.23g/mol[1,1'-Biphenyl]-2-carboxylicacid, 2'-formyl-
CAS:Formula:C14H10O3Purity:96%Color and Shape:SolidMolecular weight:226.2274