
CAS 67206-26-2: N-Chloroacetyl-DL-norleucine
Formula:C8H14ClNO3
InChI:InChI=1/C8H14ClNO3/c1-2-3-4-6(8(12)13)10-7(11)5-9/h6H,2-5H2,1H3,(H,10,11)(H,12,13)
SMILES:CCCCC(C(=O)O)N=C(CCl)O
Synonyms:- Chloroacetyl-DL-norleucine
- N-(chloroacetyl)norleucine
Sort by
Found 3 products.
N-Chloroacetyl-DL-norleucine
CAS:Formula:C8H14ClNO3Purity:>99.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:207.65CHLOROACETYL-DL-NORLEUCINE
CAS:Formula:C8H14ClNO3Purity:99%Color and Shape:SolidMolecular weight:207.6547N-Chloroacetyl-DL-norleucine
CAS:N-Chloroacetyl-DL-norleucine is a derivative of the lectin concanavalin A, which has been shown to have biological activity. It binds to tryptophan residues in the bacterial cell wall. It also interacts with cellular receptors on lymphocytes, causing lymphocyte activation and proliferation. N-Chloroacetyl-DL-norleucine is a divalent molecule that forms homologous and alkylated derivatives with amino acid residues on the bacterial cell wall. These molecules are dimeric and tetrameric, respectively, and form monovalent molecules when they bind to the bacterial cell wall.Formula:C8H14ClNO3Purity:Min. 95%Molecular weight:207.65 g/mol