CAS 67567-15-1: Diosbulbin G
Formula:C19H22O6
InChI:InChI=1S/C19H22O6/c1-19-7-15(9-2-3-23-8-9)25-18(22)13(19)6-14-16-11(17(21)24-14)4-10(20)5-12(16)19/h2-3,8,10-16,20H,4-7H2,1H3
InChI key:InChIKey=GFUMUSWDMNZQDZ-UHFFFAOYSA-N
SMILES:CC12C3C4C(CC1C(=O)OC(C2)C=5C=COC5)OC(=O)C4CC(O)C3
Synonyms:- 4H,7H-Furo[2′,3′,4′:4,5]naphtho[2,1-c]pyran-4,7-dione, 9-(3-furanyl)dodecahydro-2-hydroxy-10a-methyl-, (2R,3aR,5aS,6aS,9S,10aS,10bR,10cS)-
- NSC 310635
- (2R,3aR,5aS,6aS,9S,10aS,10bR,10cS)-9-(3-Furanyl)dodecahydro-2-hydroxy-10a-methyl-4H,7H-furo[2′,3′,4′:4,5]naphtho[2,1-c]pyran-4,7-dione
- 4H,7H-Furo[2′,3′,4′:4,5]naphtho[2,1-c]pyran-4,7-dione, 9-(3-furanyl)dodecahydro-2-hydroxy-10a-methyl-, [2R-(2α,3aβ,5aβ,6aα,9β,10aβ,10bα,10cβ)]-
- Diosbulbin G
Sort by
Found 4 products.
(2R,3aα,5aα,6aβ,10bβ,10cα)-9α-(3-Furyl)dodecahydro-2β-hydroxy-10aα-methyl-4H,7H-furo[2',3',4'
CAS:Formula:C19H22O6Purity:97.0%Molecular weight:346.3744Diosbulbin G
CAS:Diosbulbin G is a natural product of Dioscorea, Dioscoreaceae.Formula:C19H22O6Purity:98%Color and Shape:SolidMolecular weight:346.379Diosbulbin G
CAS:Diosbulbin G is a naturally occurring compound, which is a type of diterpenoid lactone isolated from the plant Dioscorea bulbifera, commonly known as air potato. This plant is a perennial vine native to Africa and Asia. Diosbulbin G exhibits its mode of action primarily through the induction of oxidative stress and apoptosis in cancer cells. It triggers cellular mechanisms that lead to programmed cell death, thereby interfering with the proliferation of malignant cells. The compound has shown promise in preclinical studies for its anticancer potential, particularly in liver, lung, and breast cancer models. Its ability to selectively induce cytotoxicity in cancerous tissues while sparing normal cells makes it a subject of interest for further oncological research. Additionally, Diosbulbin G's natural origin and unique mechanism provide an avenue for the development of novel cancer therapeutics with fewer side effects compared to conventional treatments.Formula:C19H22O6Purity:Min. 95%Molecular weight:346.4 g/mol
