
CAS 6802-49-9: 7-methoxy-2-(3-methoxyphenyl)-4H-chromen-4-one
Formula:C17H14O4
InChI:InChI=1/C17H14O4/c1-19-12-5-3-4-11(8-12)16-10-15(18)14-7-6-13(20-2)9-17(14)21-16/h3-10H,1-2H3
SMILES:COc1cccc(c1)c1cc(=O)c2ccc(cc2o1)OC
Synonyms:- 4H-1-Benzopyran-4-one, 7-methoxy-2-(3-methoxyphenyl)-
- 7-Methoxy-2-(3-methoxyphenyl)-4H-1-benzopyran-4-one
- Flavone, 3',7-dimethoxy-
Sort by
Found 2 products.
7,3'-Dimethoxyflavone
CAS:Controlled ProductFormula:C17H14O4Color and Shape:NeatMolecular weight:282.2917,3'-Dimethoxyflavone
CAS:7,3'-Dimethoxyflavone is a flavonoid compound, which is a type of secondary metabolite found in various plants. This compound is primarily sourced from the leaves and stems of certain plant species, where it acts as a natural protector against pathogens and contributes to the plant's development and survival mechanisms. Flavonoids like 7,3'-Dimethoxyflavone exert their biological effects through several modes of action, including antioxidant activity, modulation of enzyme function, and interaction with cell signaling pathways. They are known to scavenge free radicals and reduce oxidative stress, thereby protecting biological systems from damage. Research into 7,3'-Dimethoxyflavone has highlighted its potential use in therapeutic applications. It is studied for its neuroprotective properties, as well as its ability to influence various cellular processes that may ameliorate conditions such as inflammation and certain neurodegenerative diseases. Additionally, the compound's potential to act as a chemopreventive agent underscores its relevance in ongoing pharmacological studies.Formula:C17H14O4Purity:Min. 95%Color and Shape:PowderMolecular weight:282.29 g/mol