
CAS 6819-07-4: 4-nitrophenyl 4-O-beta-D-xylopyranosyl-beta-D-xylopyranoside
Formula:C16H21NO11
InChI:InChI=1/C16H21NO11/c18-9-5-25-16(13(21)11(9)19)28-10-6-26-15(14(22)12(10)20)27-8-3-1-7(2-4-8)17(23)24/h1-4,9-16,18-22H,5-6H2/t9-,10-,11+,12+,13-,14-,15+,16+/m1/s1
Synonyms:- beta-D-xylopyranoside, 4-nitrophenyl 4-O-beta-D-xylopyranosyl-
Sort by
Found 1 products.
4-Nitrophenyl β-D-xylobioside
CAS:4-Nitrophenyl beta-D-xylobioside is a chromogenic substrate for xylanase. Upon hydrolysis, para-nitrophenol is released yielding a yellowish colour. 4-Nitrophenyl beta-D-xylobioside is used in different applications such as the Xylan degradation studies, paper/pulp industry applicationsFormula:C16H21NO11Purity:Min. 95%Color and Shape:White PowderMolecular weight:403.34 g/mol