![(2S)-2-[5-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-2,4-dihydroxyphenyl]-2,3-dihydro-5,7-dihydroxy-4H-…](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F347776-2s-2-5-2e-37-dimethyl-26-octadien-1-yl-24-dihydroxyphenyl-23-dihydro-57-dihydroxy-4h-1-benzopyran-4-one.webp&w=3840&q=75)
CAS 68401-05-8: (2S)-2-[5-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-2,4-dihydroxyphenyl]-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one
Formula:C25H28O6
InChI:InChI=1S/C25H28O6/c1-14(2)5-4-6-15(3)7-8-16-9-18(20(28)12-19(16)27)23-13-22(30)25-21(29)10-17(26)11-24(25)31-23/h5,7,9-12,23,26-29H,4,6,8,13H2,1-3H3/b15-7+/t23-/m0/s1
InChI key:InChIKey=GJFHZVPRFLHEBR-KETROQBRSA-N
SMILES:O=C1C=2C(O[C@@H](C1)C3=CC(C/C=C(/CCC=C(C)C)\C)=C(O)C=C3O)=CC(O)=CC2O
Synonyms:- (2S)-2-[5-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-2,4-dihydroxyphenyl]-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 2-(5-((2E)-3,7-dimethyl-2,6-octadienyl)-2,4-dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-, (2S)-
- 4H-1-Benzopyran-4-one, 2-[5-(3,7-dimethyl-2,6-octadienyl)-2,4-dihydroxyphenyl]-2,3-dihydro-5,7-dihydroxy-, [S-(E)]-
- 4H-1-Benzopyran-4-one, 2-[5-[(2E)-3,7-dimethyl-2,6-octadien-1-yl]-2,4-dihydroxyphenyl]-2,3-dihydro-5,7-dihydroxy-, (2S)-
- Kuwanon E
Sort by
Found 5 products.
Kuwanon E
CAS:Kuwanon E blocks cholinesterase; K i 3.1-37.5 μM for AChE, 1.7-19.1 μM for BChE; stops MUC5AC production in NCI-H292 cells.Formula:C25H28O6Purity:95%Color and Shape:SolidMolecular weight:424.49(S)-2-[5-[(E)-3,7-Dimethyl-2,6-octadienyl]-2,4-dihydroxyphenyl]-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one
CAS:Formula:C25H28O6Purity:98%Color and Shape:SolidMolecular weight:424.4862Kuwanon E
CAS:Kuwanon E is a natural compound, specifically a flavonoid, derived from the root bark of the mulberry tree, Morus alba. As a bioactive component, Kuwanon E exhibits significant antioxidant and anti-inflammatory effects. Its mechanism of action involves the scavenging of free radicals and the inhibition of inflammatory pathways, which contributes to its therapeutic potential. Kuwanon E has been investigated for various applications in scientific research, particularly in the fields of pharmacology and medicine. Its antioxidant properties make it a candidate for studies aimed at reducing oxidative stress-related damage in cells, while its anti-inflammatory effects have garnered interest for potential use in managing inflammatory diseases. Additionally, Kuwanon E is being explored for its antitumor activities, making it a subject of interest in cancer research. The compound's diverse pharmacological activities suggest its potential utility in developing therapeutic agents targeting various pathological conditions.Formula:C25H28O6Purity:Min. 95%Molecular weight:424.5 g/mol