
CAS 68460-01-5: 3H-2,1-Benzoxathiol-3-one, 4,5,6,7-tetrabromo-, 1,1-dioxide
Formula:C7Br4O4S
InChI:InChI=1S/C7Br4O4S/c8-2-1-6(5(11)4(10)3(2)9)16(13,14)15-7(1)12
InChI key:InChIKey=QPGYGIVRJIICGZ-UHFFFAOYSA-N
SMILES:O=C1C=2C(S(=O)(=O)O1)=C(Br)C(Br)=C(Br)C2Br
Synonyms:- 3,4,5,6-Tetrabromo-2-sulfobenzoic acid cyclic anhydride
- 3H-2,1-Benzoxathiol-3-one, 4,5,6,7-tetrabromo-, 1,1-dioxide
- 4,5,6,7-Tetrabromo-o-sulfobenzoic anhydride
- Tetrabromo-2-sulfobenzoic acid cyclic anhydride
- Tetrabromo-2-sulfobenzoic acid cycloanhydride
- Tetrabromo-o-sulfobenzoic acid cyclic anhydride
- Tetrabromo-o-sulfobenzoic anhydride
Sort by
Found 5 products.
4,5,6,7-Tetrabromo-3H-benzo[c][1,2]oxathiol-3-one 1,1-dioxide
CAS:Formula:C7Br4O4SPurity:98%Color and Shape:SolidMolecular weight:499.7535Tetrabromo-2-sulfobenzoic acid cyclic anhydride
CAS:Tetrabromo-2-sulfobenzoic acid cyclic anhydride (TBA) is a bifunctional monomer that is used in the production of polyesters. TBA is polymerized with terephthalic acid to produce poly(ethylene terephthalate), which is used in the manufacture of plastics and fibers. The TBA molecule has two reactive groups, one of which is a bromine atom that reacts with an alcohol group on another molecule to form a cyclic anhydride. This reaction leads to the formation of a carbon-oxygen-bromine ring, which can react with other molecules containing alcohol groups. The second reactive group on the TBA molecule is a sulfonic acid group that reacts with carboxylic acids or phenols to form esters. In the presence of ethylene glycol and trimellitic acid, TBA forms a film that can be used as a protective coating for paperboard packaging materials.Formula:C7Br4O4SPurity:Min. 95%Molecular weight:499.75 g/molRef: 3D-FT75142
Discontinued productTetrabromo-o-sulfobenzoic Anhydride
CAS:Formula:C7Br4O4SPurity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:499.75