CAS 6871-21-2: Asimilobine
Formula:C17H17NO2
InChI:InChI=1S/C17H17NO2/c1-20-17-14(19)9-11-6-7-18-13-8-10-4-2-3-5-12(10)16(17)15(11)13/h2-5,9,13,18-19H,6-8H2,1H3/t13-/m1/s1
InChI key:InChIKey=NBDNEUOVIJYCGZ-CYBMUJFWSA-N
SMILES:O(C)C1=C2C=3[C@@](CC=4C2=CC=CC4)(NCCC3C=C1O)[H]
Synonyms:- (-)-Asimilobine
- (6aR)-5,6,6a,7-Tetrahydro-1-methoxy-4H-dibenzo[de,g]quinolin-2-ol
- 4H-Dibenzo(de,g)quinolin-2-ol, 5,6,6a,7-tetrahydro-1-methoxy-, (R)-
- 4H-Dibenzo[de,g]quinolin-2-ol, 5,6,6a,7-tetrahydro-1-methoxy-, (6aR)-
- 6aβ-Noraporphin-2-ol, 1-methoxy-
Sort by
Found 5 products.
Asimilobine
CAS:Asimilobine is an aporphine alkaloid, which is a type of naturally occurring chemical compound. It is primarily derived from plant sources, specifically within the Magnoliaceae family. The mode of action of asimilobine involves interactions with neurotransmitter systems, where it can modulate dopamine receptors and other neural pathways, leading to potential effects on mood, cognition, and neuroprotection. Asimilobine is used in scientific research to explore its pharmacological properties, which include potential applications in treating neurological disorders, investigating its effects on the central nervous system, and studying its possible anti-inflammatory and antioxidant activities. Its ability to interact with various neural pathways makes it a candidate for further exploration in the context of developing therapeutic agents for disorders such as depression, anxiety, and Parkinson's disease. Research continues to elucidate the full spectrum of activities and potential clinical applications of asimilobine.Formula:C17H17NO2Purity:Min. 95%Molecular weight:267.32 g/molAsimilobine
CAS:Formula:C17H17NO2Purity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:267.33Asimilobine
CAS:(-)-Asimilobine: antioxidant, anti-AChE, anti-glucosidase, anti-leishmanial, anti-fungal; weak against S. mutans, MIC 0.25 mg/mL.Formula:C17H17NO2Purity:98%Color and Shape:SolidMolecular weight:267.328
