![2,3,4,13-Tetrahydro-1H-benz[g]indolo[2,3-a]quinolizin-6-ium](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F432755-23413-tetrahydro-1h-benz-g-indolo-23-a-quinolizin-6-ium.webp&w=3840&q=75)
CAS 6882-99-1: 2,3,4,13-Tetrahydro-1H-benz[g]indolo[2,3-a]quinolizin-6-ium
Formula:C19H17N2
InChI:InChI=1S/C19H16N2/c1-2-6-14-12-21-10-9-16-15-7-3-4-8-17(15)20-19(16)18(21)11-13(14)5-1/h3-4,7-12H,1-2,5-6H2/p+1
InChI key:InChIKey=UQVUEULZDJRMJR-UHFFFAOYSA-O
SMILES:C=12C=3[N+](=CC4=C(C3)CCCC4)C=CC1C=5C(N2)=CC=CC5
Synonyms:- 1,2,3,4-Tetrahydro-13H-benz[g]indolo[2,3-a]quinolizinium
- 1H-Benz[g]indolo[2,3-a]quinolizin-6-ium, 2,3,4,13-tetrahydro-
- 2,3,4,13-Tetrahydro-1H-benz[g]indolo[2,3-a]quinolizin-6-ium
- 3,4,5,6,14,15,20,21-Octadehydroyohimban-4-ium-1-ide
- 3,4,5,6,14,15,20,21-Octadehydroyohimbanium
- 6882-99-1
- Sempervirin
- Sempervirine
- Yohimban-4-Ium, 3,4,5,6,14,15,20,21-Octadehydro-, Inner Salt
- Yohimbanium, 3,4,5,6,14,15,20,21-octadehydro-
Sort by
Found 6 products.
Sempervirine
CAS:Sempervirine can unwind circular DNA, it shows selective inhibition of in vitro synthesis of cancer DNA .Formula:C19H17N2Purity:98.81%Color and Shape:SolidMolecular weight:273.35Sempervirine
CAS:Sempervirine is an alkaloid compound derived from Gelsemium sempervirens, a plant recognized for its various bioactive components. This compound is extracted from the roots and is known for its interaction with specific biological pathways. Sempervirine primarily operates by targeting neural receptors, influencing signal transduction, and modulating neurotransmitter activity. Its mode of action involves binding to specific proteins, affecting their conformation and functional output, which may result in alterations in cellular responses. In scientific research, Sempervirine is valued for its potential applications in neuropharmacology and toxicology. Researchers utilize this compound to explore mechanisms of neural inhibition and to study its potential therapeutic effects in treating neurological disorders. Additionally, its role in cellular signaling makes it a subject of interest in understanding complex biological processes. As a research tool, Sempervirine aids in elucidating pathways that could pave the way for novel pharmacological interventions.Formula:C19H17N2Purity:Min. 95%Molecular weight:273.4 g/mol