
CAS 6938-19-8: 6-Hydroxy-5,7-dimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one
Formula:C18H16O6
InChI:InChI=1S/C18H16O6/c1-21-11-6-4-10(5-7-11)13-8-12(19)16-14(24-13)9-15(22-2)17(20)18(16)23-3/h4-9,20H,1-3H3
InChI key:InChIKey=XYHIVQHSXGOAQP-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(OC(=CC2=O)C3=CC=C(OC)C=C3)=CC(OC)=C1O
Synonyms:- 4H-1-benzopyran-4-one, 6-hydroxy-5,7-dimethoxy-2-(4-methoxyphenyl)-
- 6-Hydroxy-2-(4-methoxyphenyl)-5,7-dimethoxy-4H-1-benzopyran-4-one
- 6-Hydroxy-4',5,7-trimethoxyflavone
- 6-Hydroxy-5,7,4′-trimethoxyflavone
- 6-Hydroxy-5,7-dimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one
- Flavone, 6-hydroxy-4′,5,7-trimethoxy-
- NSC 53907
Sort by
Found 1 products.
6-Hydroxy-5,7,4'-trimethoxyflavone
CAS:6-Hydroxy-5,7,4'-trimethoxyflavone is a methoxylated flavone, which is a type of polyphenolic compound. It is derived from various natural sources, including certain plant species where flavonoids are abundant. This compound features distinct methoxy and hydroxyl groups that contribute to its biochemical activity. The mode of action of 6-Hydroxy-5,7,4'-trimethoxyflavone involves interacting with molecular pathways related to oxidative stress and inflammation. Its structure allows for antioxidant activity, potentially neutralizing free radicals and reducing cellular damage. Additionally, it may play a role in modulating enzymatic pathways, influencing various biological responses. The applications of 6-Hydroxy-5,7,4'-trimethoxyflavone are quite varied, particularly in biomedical research. It is investigated for its potential therapeutic effects, including anti-cancer, anti-inflammatory, and neuroprotective properties. Studies explore its utility in developing novel pharmaceuticals and as a model compound for understanding the effects of methoxylated flavones in biological systems. Continued research is essential to fully elucidate its capabilities and potential clinical applications.Formula:C18H16O6Purity:Min. 95%Molecular weight:328.32 g/mol