
CAS 6945-67-1: 2-Bromo-4-nitropyridine
Formula:C5H3BrN2O2
InChI:InChI=1/C5H3BrN2O2/c6-5-3-4(8(9)10)1-2-7-5/h1-3H
SMILES:c1cnc(cc1N(=O)=O)Br
Synonyms:- 2-Bromo-4-Niropyridine
Sort by
Found 5 products.
2-Bromo-4-nitropyridine
CAS:Formula:C5H3BrN2O2Purity:97%Color and Shape:SolidMolecular weight:202.99352-Bromo-4-nitropyridine
CAS:Formula:C5H3BrN2O2Purity:>95.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:203.002-Bromo-4-nitropyridine
CAS:2-Bromo-4-nitropyridine is a molecule that contains a polarizability, hydrogen bond, and molecular electrostatic potential. It has been used to study the effects of solvent on the stability of molecules. X-ray data from 2-bromo-4-nitropyridine was collected at the Argonne National Laboratory. The molecular electrostatic potential was calculated using quantum chemistry calculations and vibrational spectroscopy data. The homoconjugation in 2-bromo-4-nitropyridine is due to its acetonitrile group and nitro group, which are both electron donating groups. 2-Bromo-4-nitropyridine has been synthesized using synthetic chemistry with dipole bonds cleaving during the reaction.Formula:C5H3BrN2O2Purity:Min. 95%Molecular weight:202.99 g/mol2-Bromo-4-nitropyridine
CAS:2-Bromo-4-nitropyridineFormula:C5H3BrN2O2Purity:97% (nmr) (Typical Value in Batch COA)Color and Shape: pale yellow solidMolecular weight:202.99g/mol