
CAS 6967-88-0: 1-bromo-4-(propan-2-yloxy)benzene
Formula:C9H11BrO
InChI:InChI=1/C9H11BrO/c1-7(2)11-9-5-3-8(10)4-6-9/h3-7H,1-2H3
SMILES:CC(C)Oc1ccc(cc1)Br
Synonyms:- 1-Bromo-4-isopropoxybenzene
- 4-Bromophenyl isopropyl ether
- 4-Bromophenyl Propan-2-Yl Ether
- Benzene, 1-bromo-4-(1-methylethoxy)-
Sort by
Found 4 products.
4-bromophenyl isopropyl ether
CAS:4-bromophenyl isopropyl etherPurity:95%Molecular weight:215.09g/mol1-Bromo-4-isopropoxybenzene
CAS:Formula:C9H11BrOPurity:95%Color and Shape:LiquidMolecular weight:215.087041-Bromo-4-isopropoxybenzene
CAS:1-Bromo-4-isopropoxybenzene is a heterocyclic compound that has a stabilized structure. It is an aromatic heterocyclic compound with two rings, a benzene ring and a pyridine ring. The molecule has the dihedral angle of 60° and its shape is due to hydrogen bonding interactions. The molecule's crystal structure is composed of alternating planes of atoms. 1-Bromo-4-isopropoxybenzene has been shown to be effective in stabilizing other molecules, such as DNA and proteins.Formula:C9H11BrOPurity:Min. 95%Molecular weight:215.09 g/molRef: 3D-FB116740
Discontinued product4-Bromoisopropoxybenzene
CAS:Purity:98.0%Color and Shape:Solid, ClearMolecular weight:215.08999633789062