![2-chloro-N,N'-bis[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]benzene-1,4-dicarboxamide](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F497095-2-chloro-n-n-bis-4-45-dihydro-1h-imidazol-2-yl-phenyl-benzene-14-dicarboxamide.webp&w=3840&q=75)
CAS 70-09-7: 2-chloro-N,N'-bis[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]benzene-1,4-dicarboxamide
Formula:C26H23ClN6O2
InChI:InChI=1/C26H23ClN6O2/c27-22-15-18(25(34)32-19-6-1-16(2-7-19)23-28-11-12-29-23)5-10-21(22)26(35)33-20-8-3-17(4-9-20)24-30-13-14-31-24/h1-10,15H,11-14H2,(H,28,29)(H,30,31)(H,32,34)(H,33,35)
SMILES:c1cc(ccc1C1=NCCN1)NC(=O)c1ccc(c(c1)Cl)C(=O)Nc1ccc(cc1)C1=NCCN1
Sort by
Found 5 products.
2-Chloro-N1,N4-bis(4-(4,5-dihydro-1H-imidazol-2-yl)phenyl)terephthalamide
CAS:Purity:98%Molecular weight:486.959991455078NSC-60339
CAS:NSC-60339 is a synthetic antineoplastic agent derived from laboratory synthesis known for its targeted inhibition of specific cancer cell pathways. The compound operates by interfering with crucial cellular processes such as DNA replication or protein synthesis, depending on its exact mode of action. The main applications of NSC-60339 are in oncological research, particularly in preclinical studies aiming to elucidate the mechanisms of cancer cell proliferation and apoptosis. Scientists use this compound to investigate potential therapeutic windows and conduct pharmacodynamic assessments. By understanding the interactions of NSC-60339 with cellular targets, researchers can evaluate its efficacy and safety profile in various cancer models. Additionally, NSC-60339 can serve as a prototype molecule for developing more refined analogs within the same therapeutic class.Formula:C26H23ClN6O2Purity:Min. 95%Molecular weight:487 g/molNSC-60339
CAS:NSC-60339: AcrAB-TolC substrate, efflux pump inhibitor, potential cancer drug.Formula:C26H23ClN6O2Purity:98.78%Color and Shape:SolidMolecular weight:486.95
