
CAS 7017-48-3: 5-Bromo-2-methoxyphenylacetic acid
Formula:C9H9BrO3
InChI:InChI=1/C9H9BrO3/c1-13-8-3-2-7(10)4-6(8)5-9(11)12/h2-4H,5H2,1H3,(H,11,12)
SMILES:COc1ccc(cc1CC(=O)O)Br
Synonyms:- 2-Methoxy-5-bromophenylacetic acid
Sort by
Found 4 products.
5-Bromo-2-methoxyphenylacetic acid
CAS:Purity:98.0%Color and Shape:SolidMolecular weight:245.072006225585945-Bromo-2-methoxyphenylacetic acid
CAS:5-Bromo-2-methoxyphenylacetic acidFormula:C9H9BrO3Purity:98% by tlc (Typical Value in Batch COA)Color and Shape: beige solidMolecular weight:245.07g/mol2-(5-Bromo-2-methoxyphenyl)acetic acid
CAS:Formula:C9H9BrO3Purity:98%Color and Shape:SolidMolecular weight:245.06996000000004(5-Bromo-2-methoxyphenyl)acetic acid
CAS:5-Bromo-2-methoxyphenyl)acetic acid (BMPEA) is a hydroxylated derivative of aspartic acid. It has been shown to induce apoptotic cell death in various cell lines, including human lung cells and rat hippocampal cells. BMPEA is synthesized by the solid-phase method and is characterized by a constant structure. It can be used to treat degenerative diseases and other conditions where apoptosis is desirable, such as Alzheimer's disease, Parkinson's disease, amyotrophic lateral sclerosis, retinitis pigmentosa, and Duchenne muscular dystrophy.Formula:C9H9BrO3Purity:Min. 95%Color and Shape:PowderMolecular weight:245.07 g/mol