CAS 70588-05-5: Obtusin
Formula:C18H16O7
InChI:InChI=1S/C18H16O7/c1-7-5-8-12(18(25-4)13(7)19)15(21)11-9(14(8)20)6-10(23-2)17(24-3)16(11)22/h5-6,19,22H,1-4H3
InChI key:InChIKey=CFLNHFUPWNRWJA-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=C(O)C(OC)=C(OC)C3)=CC(C)=C(O)C2OC
Synonyms:- 1,7-Dihydroxy-2,3,8-trimethoxy-6-methyl-9,10-anthracenedione
- 1,7-Dihydroxy-2,3,8-trimethoxy-6-methylanthracene-9,10-dione
- 2,8-Dihydroxy-1,6,7-trimethoxy-3-methylanthraquinone
- 9,10-Anthracenedione, 1,7-dihydroxy-2,3,8-trimethoxy-6-methyl-
- Obtusin (Cassia)
- Obtusin
Sort by
Found 6 products.
1,7-Dihydroxy-2,3,8-trimethoxy-6-methylanthracene-9,10-dione
CAS:Formula:C18H16O7Purity:%Color and Shape:SolidMolecular weight:344.3154Obtusin
CAS:Obtusin is a plant-derived laxative, which is extracted from the leaves of certain Cassia species. It primarily consists of anthraquinone glycosides, compounds that exhibit potent laxative effects. These glycosides function by stimulating the mucosa of the large intestine, leading to increased peristaltic activity and osmotic water movement into the bowel. This mode of action effectively promotes bowel evacuation and relieves constipation. The primary use of Obtusin is in the treatment of occasional constipation. Owing to its plant origin, it is favored in contexts where naturally sourced remedies are preferred. Additionally, the presence of anthraquinones contributes not only to laxative properties but also to potential antioxidant and antimicrobial effects. Further research continues to explore its broader therapeutic applications while maintaining a focus on safety and efficacy, particularly concerning dosage and long-term use. Understanding these facets is crucial for scientists developing herbal-based treatments and investigating their pharmacodynamics and interactions.Formula:C18H16O7Purity:Min. 95%Molecular weight:344.32 g/molObtusin
CAS:Obtusin is a natural product.Formula:C18H16O7Purity:99.13%Color and Shape:SolidMolecular weight:344.32
