
CAS 713-68-8: 3-Phenoxyphenol
Formula:C12H10O2
InChI:InChI=1S/C12H10O2/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,13H
InChI key:InChIKey=HBUCPZGYBSEEHF-UHFFFAOYSA-N
SMILES:O(C1=CC(O)=CC=C1)C2=CC=CC=C2
Synonyms:- 3-Hydroxydiphenyl ether
- 3-Phenoxyphenol
- Brn 1869624
- Nsc 57079
- Phenol, 3-phenoxy-
- Phenol, m-phenoxy-
- m-Phenoxyphenol
Sort by
Found 5 products.
3-Phenoxyphenol
CAS:3-Phenoxyphenol is an organic compound that is oxidized by air to form 3-phenoxybenzoic acid. 3-Phenoxyphenol can be synthesized by the oxidative carbonylation of cyclohexanol in the presence of palladium complexes and copper chloride. The synthesis involves a two-step process, with the first step being a reaction between cyclohexanol and hydrogen peroxide in the presence of copper chloride to produce phenoxybenzoic acid. The second step involves heating phenoxybenzoic acid with sodium formate under pressure to produce 3-phenoxyphenol. The oxidation products are determined by the catalyst used, but copper can lead to formation of diphenyl ether as an impurity. Molecular modeling techniques have been used to determine that hydroxamic acids are likely intermediates in the oxidation process, which is proposed as an efficient method for producing 3-phenoxyphenol.Formula:C12H10O2Purity:Min. 95%Molecular weight:186.21 g/molRef: 3D-FP76790
Discontinued product