CAS 71367-28-7: 3,3'-anthracene-9,10-diyldipropanoic acid
Formula:C20H18O4
InChI:InChI=1/C20H18O4/c21-19(22)11-9-17-13-5-1-2-6-14(13)18(10-12-20(23)24)16-8-4-3-7-15(16)17/h1-8H,9-12H2,(H,21,22)(H,23,24)
SMILES:c1ccc2c(c1)c(CCC(=O)O)c1ccccc1c2CCC(=O)O
Synonyms:- 9,10-Anthracenedipropanoic Acid
- 3,3'-Anthracene-9,10-diyldipropanoic acid
Sort by
Found 5 products.
3,3'-(Anthracene-9,10-diyl)dipropanoic acid
CAS:Purity:97%Color and Shape:SolidMolecular weight:322.35998535156253,3'-(Anthracene-9,10-diyl)dipropanoic acid
CAS:3,3'-(Anthracene-9,10-diyl)dipropanoic acid is an anthracene compound that can be immobilized on a solid substrate. This immobilization technique has been shown to increase the efficiency of light emission and improve the stability of the ligand in vitro. 3,3'-(Anthracene-9,10-diyl)dipropanoic acid has also been used in various techniques such as microscopy and hydrophobic interaction. The interactions of 3,3'-(Anthracene-9,10-diyl)dipropanoic acid with other molecules have been studied in vitro. These studies have shown that this compound interacts with DNA and proteins by transferring electrons from one molecule to another.Formula:C20H18O4Purity:Min. 95%Molecular weight:322.36 g/mol3,3'-(Anthracene-9,10-diyl)dipropanoic acid
CAS:3,3'-(Anthracene-9,10-diyl)dipropanoic acidPurity:95%Molecular weight:322.35g/mol9,10-Anthracenedipropanoicacid
CAS:Formula:C20H18O4Purity:95%Color and Shape:SolidMolecular weight:322.35451999999987
