
CAS 7154-85-0: N-(4-Hydroxyphenyl)phthalimide
Formula:C14H9NO3
InChI:InChI=1/C14H9NO3/c16-10-7-5-9(6-8-10)15-13(17)11-3-1-2-4-12(11)14(15)18/h1-8,16H
SMILES:c1ccc2c(c1)C(=O)N(c1ccc(cc1)O)C2=O
Synonyms:- 2-(4-hydroxyphenyl)-1H-isoindole-1,3(2H)-dione
Sort by
Found 4 products.
N-(4-Hydroxyphenyl)phthalimide
CAS:N-(4-Hydroxyphenyl)phthalimide is a white powder that has a melting point of 140.5°C, and is soluble in chloroform, acetone, and ethanol. It has the chemical formula C6H4N(OH)C6H3(OCH2CH2)2 and is used as a reagent for the synthesis of phthalic anhydride. It reacts with ammonia to form phthalamide. This compound belongs to the family of compounds called phthalimides. The molecule consists of two benzene rings connected by a single bond, which contains two hydroxyl groups on opposite sides of the ring system. Hydrogen bonds are formed between these hydroxyl groups and other atoms in the molecule. These hydrogen bonds contribute to the dihedral angle of this molecule (104°).Formula:C14H9NO3Purity:Min. 95%Molecular weight:239.23 g/mol2-(4-Hydroxyphenyl)isoindoline-1,3-dione
CAS:2-(4-Hydroxyphenyl)isoindoline-1,3-dionePurity:98%Molecular weight:239.23g/molN-(4-HYDROXYPHENYL)PHTHALIMIDE
CAS:Formula:C14H9NO3Purity:95%Color and Shape:SolidMolecular weight:239.2262