
CAS 71727-40-7: 1,3-Dihydro-4,5-bis(4-methoxyphenyl)-2H-imidazol-2-one
Formula:C17H16N2O3
InChI:InChI=1S/C17H16N2O3/c1-21-13-7-3-11(4-8-13)15-16(19-17(20)18-15)12-5-9-14(22-2)10-6-12/h3-10H,1-2H3,(H2,18,19,20)
InChI key:InChIKey=JOTSGKDUQMLZLE-UHFFFAOYSA-N
SMILES:O=C1NC(=C(N1)C2=CC=C(OC)C=C2)C3=CC=C(OC)C=C3
Synonyms:- 2H-Imidazol-2-one, 1,3-dihydro-4,5-bis(4-methoxyphenyl)-
- 4-Imidazolin-2-one, 4,5-bis(p-methoxyphenyl)-
- 1,3-Dihydro-4,5-bis(4-methoxyphenyl)-2H-imidazol-2-one
Sort by
Found 3 products.
P18IN003
CAS:P18IN003 is a selective and effective p18(INK4C) inhibitor that inhibits the activity of p18 protein and can be used to study in vitro expansion ofFormula:C17H16N2O3Purity:98.77%Color and Shape:SolidMolecular weight:296.324,5-Bis(4-methoxyphenyl)-1,3-dihydroimidazol-2-one
CAS:4,5-Bis(4-methoxyphenyl)-1,3-dihydroimidazol-2-one is a selective estrogen receptor modulator (SERM), which is a synthetic compound designed to bind with high affinity and selectivity to estrogen receptors. Derived from chemical synthesis, it incorporates structural elements that enable specific interactions with estrogen receptor subtypes. The mode of action involves the binding to estrogen receptors, where it acts either as an agonist or antagonist, depending on the target tissue. This dual action is achieved through conformational changes in the receptor-ligand complex, influencing the recruitment of co-regulators and impacting gene transcription differently across tissues. This compound is under investigation for its potential therapeutic applications in conditions related to estrogen function, such as osteoporosis, breast cancer, and potentially other endocrine-related disorders. By modulating estrogen receptor activity in a targeted manner, it offers a strategic approach to achieving desired clinical outcomes while minimizing undesired systemic effects. Its selective action is particularly valuable for leveraging estrogen's beneficial effects on bone and lipid metabolism while mitigating risks associated with breast and endometrial tissues.Formula:C17H16N2O3Purity:Min. 95%Molecular weight:296.32 g/mol