CAS 71780-40-0: methyl 3-hydroxy-4-(hydroxymethyl)benzoate
Formula:C9H10O4
InChI:InChI=1/C9H10O4/c1-13-9(12)6-2-3-7(5-10)8(11)4-6/h2-4,10-11H,5H2,1H3
SMILES:COC(=O)c1ccc(CO)c(c1)O
Sort by
Found 3 products.
3-Hydroxy-4-hydroxymethyl-benzoic acid methyl ester
CAS:Purity:95.0%Molecular weight:182.1750030517578Methyl 3-hydroxy-4-(hydroxymethyl)benzoate
CAS:Methyl 3-hydroxy-4-(hydroxymethyl)benzoateMolecular weight:182.17g/molMethyl 3-hydroxy-4-(hydroxymethyl)benzoate
CAS:Methyl 3-hydroxy-4-(hydroxymethyl)benzoate is a cancer drug that can be used as a chemotherapy. It is an alkylating agent and ester that inhibits the growth of cells by causing DNA cross-links and damage to the cell's genetic material. Methyl 3-hydroxy-4-(hydroxymethyl)benzoate causes DNA breaks in the cells, which prevents replication and transcription, leading to cell death. Methyl 3-hydroxy-4-(hydroxymethyl)benzoate has been shown to have antiinflammatory effects, which may be due to its ability to inhibit prostaglandin synthesis.Formula:C9H10O4Purity:Min. 95%Molecular weight:182.18 g/mol
