
CAS 720702-41-0: Boronic acid, (1-methyl-1H-pyrazol-5-yl)-
Formula:C4H7BN2O2
InChI:InChI=1S/C4H7BN2O2/c1-7-4(5(8)9)2-3-6-7/h2-3,8-9H,1H3
SMILES:Cn1c(ccn1)B(O)O
Synonyms:- 1-Methyl-1H-pyrazole-5-boronic acid
- (1-Methyl-1H-pyrazol-5-yl)boronic acid
Sort by
Found 5 products.
1-Methyl-1H-pyrazole-5-boronic acid
CAS:1-Methyl-1H-pyrazole-5-boronic acidPurity:97%+Color and Shape:SolidMolecular weight:125.92g/mol(1-Methyl-1H-pyrazol-5-yl)boronic acid
CAS:Formula:C4H7BN2O2Purity:95%Color and Shape:SolidMolecular weight:125.9216(1-Methyl-1H-pyrazol-5-yl)boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C4H7BN2O2Color and Shape:White to Light yellow powder to crystalMolecular weight:125.921-Methyl-1H-pyrazole-5-boronic acid
CAS:1-Methyl-1H-pyrazole-5-boronic acid is an organic chemical compound that is used as a reagent in the synthesis of other compounds. It has been used as a synthetic intermediate for pharmaceuticals and agrochemicals, in particular fungicides. 1-Methyl-1H-pyrazole-5-boronic acid can be prepared by the reaction of benzoyl chloride with pinacol ester and a chloride ion. 1-Methyl-1H-pyrazole-5-boronic acid is also used in the Suzuki coupling reaction to synthesize various heterocyclic compounds, such as indoles. The palladium catalyst facilitates this reaction by reducing the amount of energy required for the reaction to occur, which is why it is sometimes called "Pd(0) catalysis".Formula:C4H7BN2O2Purity:Min. 95%Molecular weight:125.92 g/molRef: 3D-FM71760
Discontinued product1-Methylpyrazole-5-boronic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:125.91999816894531