CAS 7245-02-5: 3-methoxyflavone
Formula:C16H12O3
InChI:InChI=1/C16H12O3/c1-18-16-14(17)12-9-5-6-10-13(12)19-15(16)11-7-3-2-4-8-11/h2-10H,1H3
SMILES:COc1c(=O)c2ccccc2oc1c1ccccc1
Synonyms:- 3-Methoxy-2-phenyl-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 3-methoxy-2-phenyl-
- 3-methoxy-2-phenyl-4H-chromen-4-one
Sort by
Found 7 products.
3-Methoxyflavone
CAS:3-Methoxyflavone is a synthetic flavonoid, which is a type of product known for its biological activities and potential therapeutic applications. It is derived from flavones, naturally occurring compounds found in various plants, known for their role in plant pigmentation and UV protection. The compound's mode of action is primarily through interaction with various biological targets, including modulation of enzyme activity and regulation of signal transduction pathways. In scientific research, 3-Methoxyflavone is being investigated for its antioxidant, anti-inflammatory, and potential neuroprotective properties. Its ability to scavenge free radicals and reduce oxidative stress makes it a subject of interest in the study of age-related diseases and neurodegenerative disorders. Additionally, its role in modulating cellular pathways provides insights into its potential in cancer research, particularly in inhibiting tumor cell proliferation and inducing apoptosis. These studies contribute to the broader understanding of 3-Methoxyflavone's capacity to influence physiological processes, paving the way for potential development in therapeutic applications.Formula:C16H12O3Purity:Min. 95%Color and Shape:White PowderMolecular weight:252.26 g/mol3-Methoxyflavone
CAS:3-Methoxyflavone is a Flavonoids, with antiviral activityFormula:C16H12O3Purity:99.29% - 99.97%Color and Shape:SolidMolecular weight:252.263-Methoxyflavone
CAS:Formula:C16H12O3Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:252.27
