
CAS 72479-05-1: (5S)-5-(bromomethyl)pyrrolidin-2-one
Formula:C5H8BrNO
InChI:InChI=1/C5H8BrNO/c6-3-4-1-2-5(8)7-4/h4H,1-3H2,(H,7,8)/t4-/m0/s1
SMILES:C1CC(=N[C@@H]1CBr)O
Synonyms:- (5S)-5-(Brommethyl)pyrrolidin-2-on
- 2-pyrrolidinone, 5-(bromomethyl)-, (5S)-
- (S)-5-(Bromomethyl)-2-Pyrrolidinone
- (5S)-5-(Bromomethyl)pyrrolidin-2-one
Sort by
Found 4 products.
(S)-(+)-5-Bromomethyl-2-pyrrolidinone
CAS:(S)-(+)-5-Bromomethyl-2-pyrrolidinone is an antibacterial agent that belongs to the group of nitrogenous heterocyclic compounds. It binds to the active site of a bacterial enzyme, which prevents the formation of acylhomoserine and blocks the synthesis of peptidoglycan. This molecule has been shown to be effective against gram-negative bacteria, but not against lactamase-producing strains or those resistant to other antibiotics. (S)-(+)-5-Bromomethyl-2-pyrrolidinone has a structural modification that allows it to bind more tightly and specifically than penicillin G, which increases its antibacterial activity. This drug is also useful for treating endocytic infections caused by gram-negative bacteria from different species because it does not have any cross reactivity with ribosomal RNA sequences from other organisms.Formula:C5H8BrNOPurity:Min. 95%Molecular weight:178.03 g/molRef: 3D-FB154825
Discontinued product(S)-(+)-5-Bromomethyl-2-pyrrolidinone
CAS:Formula:C5H8BrNOPurity:95%Color and Shape:SolidMolecular weight:178.02712000000005(S)-5-Bromomethyl-2-oxopyrrolidine
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:178.0290069580078(S)-5-(Bromomethyl)-2-pyrrolidinone
CAS:(S)-5-(Bromomethyl)-2-pyrrolidinonePurity:97+%Molecular weight:178.03g/mol