
CAS 725-05-3: 4'-Methoxybiphenyl-3-carboxylic acid
Formula:C14H12O3
InChI:InChI=1/C14H12O3/c1-17-13-7-5-10(6-8-13)11-3-2-4-12(9-11)14(15)16/h2-9H,1H3,(H,15,16)
SMILES:COc1ccc(cc1)c1cccc(c1)C(=O)O
Synonyms:- 4'-Methoxybiphenyl-3-Carboxylate
- 4'-Methoxy-Biphenyl-3-Carboxylic Acid
Sort by
Found 3 products.
3-(4-Methoxyphenyl)benzoic acid
CAS:Purity:95.0%Color and Shape:Solid, PowderMolecular weight:228.24699401855474'-Methoxy-biphenyl-3-carboxylic acid
CAS:4'-Methoxy-biphenyl-3-carboxylic acid is a chemical compound that is used in organic synthesis. It can be synthesized from phenol and the aryl bromide. The reaction sequence involves two catalytic steps: an oxidative coupling of the phenol to 4'-methoxy-biphenyl-3-carboxylic acid and then a reductive coupling of furylacetic acid to biphenyl. This product has been shown to have high catalytic activity, which is due to its ability to regenerate the palladium catalyst used in the first step of the reaction sequence. It can be reused many times before it loses its catalytic activity.Formula:C14H12O3Purity:Min. 95%Molecular weight:228.24 g/molRef: 3D-FM33165
Discontinued product